C8H9F4N3 — CID 106294297
6-methyl-N-(2,2,3,3-tetrafluoropropyl)pyridazin-3-amine (PubChem CID 106294297) has the molecular formula C8H9F4N3 and a molecular weight of 223.17 g/mol. Its IUPAC name is 6-methyl-N-(2,2,3,3-tetrafluoropropyl)pyridazin-3-amine.
| Compound Name | 6-methyl-N-(2,2,3,3-tetrafluoropropyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 106294297 |
| Molecular Formula | C8H9F4N3 |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 6-methyl-N-(2,2,3,3-tetrafluoropropyl)pyridazin-3-amine |
| SMILES | Cc1ccc(NCC(F)(F)C(F)F)nn1 |
| InChI | InChI=1S/C8H9F4N3/c1-5-2-3-6(15-14-5)13-4-8(11,12)7(9)10/h2-3,7H,4H2,1H3,(H,13,15) |
| InChIKey | QPBHSVKPRSRPBD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|