C8H7BrF4N2 — CID 106293353
6-bromo-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine (PubChem CID 106293353) has the molecular formula C8H7BrF4N2 and a molecular weight of 287.05 g/mol. Its IUPAC name is 6-bromo-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine.
| Compound Name | 6-bromo-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106293353 |
| Molecular Formula | C8H7BrF4N2 |
| Molecular Weight | 287.05 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 6-bromo-N-(2,2,3,3-tetrafluoropropyl)pyridin-2-amine |
| SMILES | FC(F)C(F)(F)CNc1cccc(Br)n1 |
| InChI | InChI=1S/C8H7BrF4N2/c9-5-2-1-3-6(15-5)14-4-8(12,13)7(10)11/h1-3,7H,4H2,(H,14,15) |
| InChIKey | OHFGLIXEALQVPC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.05 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|