C10H8Br2N4 — CID 167065966
1,2-bis(6-bromo-2-pyridinyl)hydrazine (PubChem CID 167065966) has the molecular formula C10H8Br2N4 and a molecular weight of 344.01 g/mol. Its IUPAC name is 1,2-bis(6-bromo-2-pyridinyl)hydrazine.
| Compound Name | 1,2-bis(6-bromo-2-pyridinyl)hydrazine |
|---|---|
| PubChem CID | 167065966 |
| Molecular Formula | C10H8Br2N4 |
| Molecular Weight | 344.01 g/mol |
| Exact Mass | 341.91 |
| IUPAC Name | 1,2-bis(6-bromo-2-pyridinyl)hydrazine |
| SMILES | Brc1cccc(NNc2cccc(Br)n2)n1 |
| InChI | InChI=1S/C10H8Br2N4/c11-7-3-1-5-9(13-7)15-16-10-6-2-4-8(12)14-10/h1-6H,(H,13,15)(H,14,16) |
| InChIKey | XXSUFTSYGOKDFZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.01 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|