C14H26N4 — CID 80946225
4-N-butyl-6-N,2-dipropylpyrimidine-4,6-diamine (PubChem CID 80946225) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is 4-N-butyl-6-N,2-dipropylpyrimidine-4,6-diamine.
| Compound Name | 4-N-butyl-6-N,2-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80946225 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 4-N-butyl-6-N,2-dipropylpyrimidine-4,6-diamine |
| SMILES | CCCCNc1cc(NCCC)nc(CCC)n1 |
| InChI | InChI=1S/C14H26N4/c1-4-7-10-16-14-11-13(15-9-6-3)17-12(18-14)8-5-2/h11H,4-10H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | WQUZOZGGPCCRLF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|