C13H23N3 — CID 79413331
2-butyl-6-ethyl-N-propylpyrimidin-4-amine (PubChem CID 79413331) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 2-butyl-6-ethyl-N-propylpyrimidin-4-amine.
| Compound Name | 2-butyl-6-ethyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79413331 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 2-butyl-6-ethyl-N-propylpyrimidin-4-amine |
| SMILES | CCCCc1nc(CC)cc(NCCC)n1 |
| InChI | InChI=1S/C13H23N3/c1-4-7-8-12-15-11(6-3)10-13(16-12)14-9-5-2/h10H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | IFCMZBRSRCQGPU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |