C10H18N4 — CID 79413062
(2-butyl-6-ethylpyrimidin-4-yl)hydrazine (PubChem CID 79413062) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (2-butyl-6-ethylpyrimidin-4-yl)hydrazine.
| Compound Name | (2-butyl-6-ethylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 79413062 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (2-butyl-6-ethylpyrimidin-4-yl)hydrazine |
| SMILES | CCCCc1nc(CC)cc(NN)n1 |
| InChI | InChI=1S/C10H18N4/c1-3-5-6-9-12-8(4-2)7-10(13-9)14-11/h7H,3-6,11H2,1-2H3,(H,12,13,14) |
| InChIKey | XBHQIIKXTOMTTJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|