C12H23N5 — CID 115347105
2-[4-hydrazinyl-6-(2-methylpropyl)pyrimidin-2-yl]-N,N-dimethylethanamine (PubChem CID 115347105) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-[4-hydrazinyl-6-(2-methylpropyl)pyrimidin-2-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-hydrazinyl-6-(2-methylpropyl)pyrimidin-2-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 115347105 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 2-[4-hydrazinyl-6-(2-methylpropyl)pyrimidin-2-yl]-N,N-dimethylethanamine |
| SMILES | CC(C)Cc1cc(NN)nc(CCN(C)C)n1 |
| InChI | InChI=1S/C12H23N5/c1-9(2)7-10-8-12(16-13)15-11(14-10)5-6-17(3)4/h8-9H,5-7,13H2,1-4H3,(H,14,15,16) |
| InChIKey | WHNVWXBJFARIJR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|