C11H20N4 — CID 79413063
(2-butyl-6-propan-2-ylpyrimidin-4-yl)hydrazine (PubChem CID 79413063) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is (2-butyl-6-propan-2-ylpyrimidin-4-yl)hydrazine.
| Compound Name | (2-butyl-6-propan-2-ylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 79413063 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | (2-butyl-6-propan-2-ylpyrimidin-4-yl)hydrazine |
| SMILES | CCCCc1nc(NN)cc(C(C)C)n1 |
| InChI | InChI=1S/C11H20N4/c1-4-5-6-10-13-9(8(2)3)7-11(14-10)15-12/h7-8H,4-6,12H2,1-3H3,(H,13,14,15) |
| InChIKey | YSCHJBNCEDUSJL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|