C12H21N3O — CID 79412373
2-butyl-N-ethyl-6-(methoxymethyl)pyrimidin-4-amine (PubChem CID 79412373) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-butyl-N-ethyl-6-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 2-butyl-N-ethyl-6-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79412373 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-butyl-N-ethyl-6-(methoxymethyl)pyrimidin-4-amine |
| SMILES | CCCCc1nc(COC)cc(NCC)n1 |
| InChI | InChI=1S/C12H21N3O/c1-4-6-7-11-14-10(9-16-3)8-12(15-11)13-5-2/h8H,4-7,9H2,1-3H3,(H,13,14,15) |
| InChIKey | ILKCGBBZEIEBFE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |