C15H25N3OS — CID 65144656
2-(cyclohexylsulfanylmethyl)-N-ethyl-6-(methoxymethyl)pyrimidin-4-amine (PubChem CID 65144656) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is 2-(cyclohexylsulfanylmethyl)-N-ethyl-6-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 2-(cyclohexylsulfanylmethyl)-N-ethyl-6-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 65144656 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-(cyclohexylsulfanylmethyl)-N-ethyl-6-(methoxymethyl)pyrimidin-4-amine |
| SMILES | CCNc1cc(COC)nc(CSC2CCCCC2)n1 |
| InChI | InChI=1S/C15H25N3OS/c1-3-16-14-9-12(10-19-2)17-15(18-14)11-20-13-7-5-4-6-8-13/h9,13H,3-8,10-11H2,1-2H3,(H,16,17,18) |
| InChIKey | CPOKVMROXGUXNT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |