C14H23N3S — CID 80937260
6-cyclohexylsulfanyl-N,2-diethylpyrimidin-4-amine (PubChem CID 80937260) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 6-cyclohexylsulfanyl-N,2-diethylpyrimidin-4-amine.
| Compound Name | 6-cyclohexylsulfanyl-N,2-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80937260 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 6-cyclohexylsulfanyl-N,2-diethylpyrimidin-4-amine |
| SMILES | CCNc1cc(SC2CCCCC2)nc(CC)n1 |
| InChI | InChI=1S/C14H23N3S/c1-3-12-16-13(15-4-2)10-14(17-12)18-11-8-6-5-7-9-11/h10-11H,3-9H2,1-2H3,(H,15,16,17) |
| InChIKey | BOFHXRUHEIOAAT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |