C11H19N3O2 — CID 65091955
6-(methoxymethyl)-2-(3-methoxypropyl)-N-methylpyrimidin-4-amine (PubChem CID 65091955) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is 6-(methoxymethyl)-2-(3-methoxypropyl)-N-methylpyrimidin-4-amine.
| Compound Name | 6-(methoxymethyl)-2-(3-methoxypropyl)-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 65091955 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 6-(methoxymethyl)-2-(3-methoxypropyl)-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(COC)nc(CCCOC)n1 |
| InChI | InChI=1S/C11H19N3O2/c1-12-11-7-9(8-16-3)13-10(14-11)5-4-6-15-2/h7H,4-6,8H2,1-3H3,(H,12,13,14) |
| InChIKey | GAXHVORQUBPZSB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|