C11H16F4N4 — CID 106296158
5-methyl-2-propyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine (PubChem CID 106296158) has the molecular formula C11H16F4N4 and a molecular weight of 280.27 g/mol. Its IUPAC name is 5-methyl-2-propyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine.
| Compound Name | 5-methyl-2-propyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106296158 |
| Molecular Formula | C11H16F4N4 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 5-methyl-2-propyl-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine |
| SMILES | CCCc1nc(N)c(C)c(NCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C11H16F4N4/c1-3-4-7-18-8(16)6(2)9(19-7)17-5-11(14,15)10(12)13/h10H,3-5H2,1-2H3,(H3,16,17,18,19) |
| InChIKey | AEVCRBLFIAHWOH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|