C16H30N4 — CID 107819112
4-N-(2-ethylhexyl)-5-methyl-2-propylpyrimidine-4,6-diamine (PubChem CID 107819112) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is 4-N-(2-ethylhexyl)-5-methyl-2-propylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-ethylhexyl)-5-methyl-2-propylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107819112 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 4-N-(2-ethylhexyl)-5-methyl-2-propylpyrimidine-4,6-diamine |
| SMILES | CCCCC(CC)CNc1nc(CCC)nc(N)c1C |
| InChI | InChI=1S/C16H30N4/c1-5-8-10-13(7-3)11-18-16-12(4)15(17)19-14(20-16)9-6-2/h13H,5-11H2,1-4H3,(H3,17,18,19,20) |
| InChIKey | ODDIMMJPSONHIC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |