C12H23N3S — CID 107819499
5-N-(2-ethylhexyl)-4-methyl-1,2-thiazole-3,5-diamine (PubChem CID 107819499) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 5-N-(2-ethylhexyl)-4-methyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(2-ethylhexyl)-4-methyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 107819499 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 5-N-(2-ethylhexyl)-4-methyl-1,2-thiazole-3,5-diamine |
| SMILES | CCCCC(CC)CNc1snc(N)c1C |
| InChI | InChI=1S/C12H23N3S/c1-4-6-7-10(5-2)8-14-12-9(3)11(13)15-16-12/h10,14H,4-8H2,1-3H3,(H2,13,15) |
| InChIKey | ZGAGYBZNPJOOOV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |