C11H21N3OS — CID 103365604
4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine (PubChem CID 103365604) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103365604 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine |
| SMILES | CCOc1c(N)nsc1NCC(CC)CC |
| InChI | InChI=1S/C11H21N3OS/c1-4-8(5-2)7-13-11-9(15-6-3)10(12)14-16-11/h8,13H,4-7H2,1-3H3,(H2,12,14) |
| InChIKey | PSTRUPMVANJPOC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |