About 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine
4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine (PubChem CID 103365604) has the molecular formula C11H21N3OS
and a molecular weight of 243.38 g/mol. Its IUPAC name is 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine |
| PubChem CID | 103365604 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine |
| SMILES | CCOc1c(N)nsc1NCC(CC)CC |
| InChI | InChI=1S/C11H21N3OS/c1-4-8(5-2)7-13-11-9(15-6-3)10(12)14-16-11/h8,13H,4-7H2,1-3H3,(H2,12,14) |
| InChIKey | PSTRUPMVANJPOC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine?
The IUPAC name of 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine (CID 103365604) is 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine.
What is the SMILES notation for 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine?
The canonical SMILES for 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine is CCOc1c(N)nsc1NCC(CC)CC.
What is the InChIKey of 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine?
The InChIKey is PSTRUPMVANJPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3OS/c1-4-8(5-2)7-13-11-9(15-6-3)10(12)14-16-11/h8,13H,4-7H2,1-3H3,(H2,12,14).
What are the key properties of 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine?
4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine has a molecular weight of 243.38 g/mol, XLogP of 2.97, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-5-N-(2-ethylbutyl)-1,2-thiazole-3,5-diamine is sourced from PubChem (CID 103365604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).