C13H25N3OS — CID 103360011
4-ethoxy-5-N-octan-2-yl-1,2-thiazole-3,5-diamine (PubChem CID 103360011) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is 4-ethoxy-5-N-octan-2-yl-1,2-thiazole-3,5-diamine.
| Compound Name | 4-ethoxy-5-N-octan-2-yl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103360011 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-ethoxy-5-N-octan-2-yl-1,2-thiazole-3,5-diamine |
| SMILES | CCCCCCC(C)Nc1snc(N)c1OCC |
| InChI | InChI=1S/C13H25N3OS/c1-4-6-7-8-9-10(3)15-13-11(17-5-2)12(14)16-18-13/h10,15H,4-9H2,1-3H3,(H2,14,16) |
| InChIKey | ROSIMHYJCVRWFX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|