C13H24N4OS — CID 103360114
4-ethoxy-5-N-(1-propylpiperidin-4-yl)-1,2-thiazole-3,5-diamine (PubChem CID 103360114) has the molecular formula C13H24N4OS and a molecular weight of 284.43 g/mol. Its IUPAC name is 4-ethoxy-5-N-(1-propylpiperidin-4-yl)-1,2-thiazole-3,5-diamine.
| Compound Name | 4-ethoxy-5-N-(1-propylpiperidin-4-yl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103360114 |
| Molecular Formula | C13H24N4OS |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-ethoxy-5-N-(1-propylpiperidin-4-yl)-1,2-thiazole-3,5-diamine |
| SMILES | CCCN1CCC(Nc2snc(N)c2OCC)CC1 |
| InChI | InChI=1S/C13H24N4OS/c1-3-7-17-8-5-10(6-9-17)15-13-11(18-4-2)12(14)16-19-13/h10,15H,3-9H2,1-2H3,(H2,14,16) |
| InChIKey | NPGLERLSNMQGQT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |