C12H23N3OS — CID 103360909
5-N-hexan-2-yl-4-propan-2-yloxy-1,2-thiazole-3,5-diamine (PubChem CID 103360909) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is 5-N-hexan-2-yl-4-propan-2-yloxy-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-hexan-2-yl-4-propan-2-yloxy-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103360909 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 5-N-hexan-2-yl-4-propan-2-yloxy-1,2-thiazole-3,5-diamine |
| SMILES | CCCCC(C)Nc1snc(N)c1OC(C)C |
| InChI | InChI=1S/C12H23N3OS/c1-5-6-7-9(4)14-12-10(16-8(2)3)11(13)15-17-12/h8-9,14H,5-7H2,1-4H3,(H2,13,15) |
| InChIKey | ZWXZTPZDGFDEMS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |