C8H16N4OS — CID 103364840
5-(2,2-dimethylhydrazinyl)-4-propan-2-yloxy-1,2-thiazol-3-amine (PubChem CID 103364840) has the molecular formula C8H16N4OS and a molecular weight of 216.31 g/mol. Its IUPAC name is 5-(2,2-dimethylhydrazinyl)-4-propan-2-yloxy-1,2-thiazol-3-amine.
| Compound Name | 5-(2,2-dimethylhydrazinyl)-4-propan-2-yloxy-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103364840 |
| Molecular Formula | C8H16N4OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 5-(2,2-dimethylhydrazinyl)-4-propan-2-yloxy-1,2-thiazol-3-amine |
| SMILES | CC(C)Oc1c(N)nsc1NN(C)C |
| InChI | InChI=1S/C8H16N4OS/c1-5(2)13-6-7(9)11-14-8(6)10-12(3)4/h5,10H,1-4H3,(H2,9,11) |
| InChIKey | OXZCVXKUMDWTJJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|