C11H21N3O2S — CID 103360266
5-N-(4-methoxybutyl)-4-propan-2-yloxy-1,2-thiazole-3,5-diamine (PubChem CID 103360266) has the molecular formula C11H21N3O2S and a molecular weight of 259.38 g/mol. Its IUPAC name is 5-N-(4-methoxybutyl)-4-propan-2-yloxy-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-(4-methoxybutyl)-4-propan-2-yloxy-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103360266 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 5-N-(4-methoxybutyl)-4-propan-2-yloxy-1,2-thiazole-3,5-diamine |
| SMILES | COCCCCNc1snc(N)c1OC(C)C |
| InChI | InChI=1S/C11H21N3O2S/c1-8(2)16-9-10(12)14-17-11(9)13-6-4-5-7-15-3/h8,13H,4-7H2,1-3H3,(H2,12,14) |
| InChIKey | BGIZBIVBSGYXMA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|