C10H18N4O2S — CID 114162925
5-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]pentanamide (PubChem CID 114162925) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is 5-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]pentanamide.
| Compound Name | 5-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]pentanamide |
|---|---|
| PubChem CID | 114162925 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 5-[(3-amino-4-ethoxy-1,2-thiazol-5-yl)amino]pentanamide |
| SMILES | CCOc1c(N)nsc1NCCCCC(N)=O |
| InChI | InChI=1S/C10H18N4O2S/c1-2-16-8-9(12)14-17-10(8)13-6-4-3-5-7(11)15/h13H,2-6H2,1H3,(H2,11,15)(H2,12,14) |
| InChIKey | CHKZVYVYABNKGY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|