C13H23N3O2S — CID 103383798
methyl 3-amino-5-(octylamino)-1,2-thiazole-4-carboxylate (PubChem CID 103383798) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is methyl 3-amino-5-(octylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | methyl 3-amino-5-(octylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 103383798 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | methyl 3-amino-5-(octylamino)-1,2-thiazole-4-carboxylate |
| SMILES | CCCCCCCCNc1snc(N)c1C(=O)OC |
| InChI | InChI=1S/C13H23N3O2S/c1-3-4-5-6-7-8-9-15-12-10(13(17)18-2)11(14)16-19-12/h15H,3-9H2,1-2H3,(H2,14,16) |
| InChIKey | OIXXXPRCMRPLMZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|