C12H22N4 — CID 107818873
2-N-(2-ethylhexyl)pyrazine-2,5-diamine (PubChem CID 107818873) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 2-N-(2-ethylhexyl)pyrazine-2,5-diamine.
| Compound Name | 2-N-(2-ethylhexyl)pyrazine-2,5-diamine |
|---|---|
| PubChem CID | 107818873 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2-N-(2-ethylhexyl)pyrazine-2,5-diamine |
| SMILES | CCCCC(CC)CNc1cnc(N)cn1 |
| InChI | InChI=1S/C12H22N4/c1-3-5-6-10(4-2)7-15-12-9-14-11(13)8-16-12/h8-10H,3-7H2,1-2H3,(H2,13,14)(H,15,16) |
| InChIKey | MMGKYVCCGLFLJK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |