C13H24N4 — CID 129414271
4-N-[(2R)-2-ethylhexyl]-6-N-methylpyrimidine-4,6-diamine (PubChem CID 129414271) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 4-N-[(2R)-2-ethylhexyl]-6-N-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[(2R)-2-ethylhexyl]-6-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 129414271 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 4-N-[(2R)-2-ethylhexyl]-6-N-methylpyrimidine-4,6-diamine |
| SMILES | CCCC[C@@H](CC)CNc1cc(NC)ncn1 |
| InChI | InChI=1S/C13H24N4/c1-4-6-7-11(5-2)9-15-13-8-12(14-3)16-10-17-13/h8,10-11H,4-7,9H2,1-3H3,(H2,14,15,16,17)/t11-/m1/s1 |
| InChIKey | QEXADYASPZOZNG-LLVKDONJSA-N |
| XLogP | 3.15 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |