C10H18N4 — CID 80652876
2-N-hexylpyrazine-2,5-diamine (PubChem CID 80652876) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-N-hexylpyrazine-2,5-diamine.
| Compound Name | 2-N-hexylpyrazine-2,5-diamine |
|---|---|
| PubChem CID | 80652876 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2-N-hexylpyrazine-2,5-diamine |
| SMILES | CCCCCCNc1cnc(N)cn1 |
| InChI | InChI=1S/C10H18N4/c1-2-3-4-5-6-12-10-8-13-9(11)7-14-10/h7-8H,2-6H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | VIEUSFHVQMIJHX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|