C12H22N4 — CID 115565252
2-N-octylpyrazine-2,5-diamine (PubChem CID 115565252) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 2-N-octylpyrazine-2,5-diamine.
| Compound Name | 2-N-octylpyrazine-2,5-diamine |
|---|---|
| PubChem CID | 115565252 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2-N-octylpyrazine-2,5-diamine |
| SMILES | CCCCCCCCNc1cnc(N)cn1 |
| InChI | InChI=1S/C12H22N4/c1-2-3-4-5-6-7-8-14-12-10-15-11(13)9-16-12/h9-10H,2-8H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | DAXLRKLVKDVENG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|