C8H10F4N4O — CID 106296253
5-methoxy-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine (PubChem CID 106296253) has the molecular formula C8H10F4N4O and a molecular weight of 254.19 g/mol. Its IUPAC name is 5-methoxy-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine.
| Compound Name | 5-methoxy-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106296253 |
| Molecular Formula | C8H10F4N4O |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 5-methoxy-4-N-(2,2,3,3-tetrafluoropropyl)pyrimidine-4,6-diamine |
| SMILES | COc1c(N)ncnc1NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H10F4N4O/c1-17-4-5(13)15-3-16-6(4)14-2-8(11,12)7(9)10/h3,7H,2H2,1H3,(H3,13,14,15,16) |
| InChIKey | UUXHOWDWKKBICU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|