C24H28ClF3N8O3 — CID 69057949
6-[[4-[(4-chloro-1-methylpyrazol-3-yl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 69057949) has the molecular formula C24H28ClF3N8O3 and a molecular weight of 568.99 g/mol. Its IUPAC name is 6-[[4-[(4-chloro-1-methylpyrazol-3-yl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 6-[[4-[(4-chloro-1-methylpyrazol-3-yl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 69057949 |
| Molecular Formula | C24H28ClF3N8O3 |
| Molecular Weight | 568.99 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 6-[[4-[(4-chloro-1-methylpyrazol-3-yl)methylamino]cyclohexyl]methyl]-5-nitro-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | Cn1cc(Cl)c(CNC2CCC(Cc3nc(NCc4ccccc4OC(F)(F)F)nc(N)c3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C24H28ClF3N8O3/c1-35-13-17(25)19(34-35)12-30-16-8-6-14(7-9-16)10-18-21(36(37)38)22(29)33-23(32-18)31-11-15-4-2-3-5-20(15)39-24(26,27)28/h2-5,13-14,16,30H,6-12H2,1H3,(H3,29,31,32,33) |
| InChIKey | XHRLNBBKICGGNQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.99 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|