About 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine
4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine (PubChem CID 67456631) has the molecular formula C21H22N4O2
and a molecular weight of 362.43 g/mol. Its IUPAC name is 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine.
Molecular Properties
| Compound Name | 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine |
| PubChem CID | 67456631 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine |
| SMILES | C=Cc1cc(Cc2ccccc2)c([N+](=O)[O-])c(N)n1.NCc1ccccc1 |
| InChI | InChI=1S/C14H13N3O2.C7H9N/c1-2-12-9-11(8-10-6-4-3-5-7-10)13(17(18)19)14(15)16-12;8-6-7-4-2-1-3-5-7/h2-7,9H,1,8H2,(H2,15,16);1-5H,6,8H2 |
| InChIKey | WQCZVDMBTNNZJB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine?
The IUPAC name of 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine (CID 67456631) is 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine.
What is the SMILES notation for 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine?
The canonical SMILES for 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine is C=Cc1cc(Cc2ccccc2)c([N+](=O)[O-])c(N)n1.NCc1ccccc1.
What is the InChIKey of 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine?
The InChIKey is WQCZVDMBTNNZJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2.C7H9N/c1-2-12-9-11(8-10-6-4-3-5-7-10)13(17(18)19)14(15)16-12;8-6-7-4-2-1-3-5-7/h2-7,9H,1,8H2,(H2,15,16);1-5H,6,8H2.
What are the key properties of 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine?
4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine has a molecular weight of 362.43 g/mol, XLogP of 3.95, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-6-ethenyl-3-nitropyridin-2-amine;phenylmethanamine is sourced from PubChem (CID 67456631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).