C19H20N4 — CID 19038977
5,6-dibenzylpyridine-2,3,4-triamine (PubChem CID 19038977) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 5,6-dibenzylpyridine-2,3,4-triamine.
| Compound Name | 5,6-dibenzylpyridine-2,3,4-triamine |
|---|---|
| PubChem CID | 19038977 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 5,6-dibenzylpyridine-2,3,4-triamine |
| SMILES | Nc1nc(Cc2ccccc2)c(Cc2ccccc2)c(N)c1N |
| InChI | InChI=1S/C19H20N4/c20-17-15(11-13-7-3-1-4-8-13)16(23-19(22)18(17)21)12-14-9-5-2-6-10-14/h1-10H,11-12,21H2,(H4,20,22,23) |
| InChIKey | XFNDRMNDHDYMNT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |