About 5-benzylfuran-2-amine
5-benzylfuran-2-amine (PubChem CID 68934924) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is 5-benzylfuran-2-amine.
Molecular Properties
| Compound Name | 5-benzylfuran-2-amine |
| PubChem CID | 68934924 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5-benzylfuran-2-amine |
| SMILES | Nc1ccc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C11H11NO/c12-11-7-6-10(13-11)8-9-4-2-1-3-5-9/h1-7H,8,12H2 |
| InChIKey | KWLNOKLHYLKCCI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzylfuran-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzylfuran-2-amine?
The IUPAC name of 5-benzylfuran-2-amine (CID 68934924) is 5-benzylfuran-2-amine.
What is the SMILES notation for 5-benzylfuran-2-amine?
The canonical SMILES for 5-benzylfuran-2-amine is Nc1ccc(Cc2ccccc2)o1.
What is the InChIKey of 5-benzylfuran-2-amine?
The InChIKey is KWLNOKLHYLKCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c12-11-7-6-10(13-11)8-9-4-2-1-3-5-9/h1-7H,8,12H2.
What are the key properties of 5-benzylfuran-2-amine?
5-benzylfuran-2-amine has a molecular weight of 173.22 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzylfuran-2-amine is sourced from PubChem (CID 68934924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).