C17H16N2 — CID 19896349
4-benzylnaphthalene-1,8-diamine (PubChem CID 19896349) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-benzylnaphthalene-1,8-diamine.
| Compound Name | 4-benzylnaphthalene-1,8-diamine |
|---|---|
| PubChem CID | 19896349 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-benzylnaphthalene-1,8-diamine |
| SMILES | Nc1cccc2c(Cc3ccccc3)ccc(N)c12 |
| InChI | InChI=1S/C17H16N2/c18-15-8-4-7-14-13(9-10-16(19)17(14)15)11-12-5-2-1-3-6-12/h1-10H,11,18-19H2 |
| InChIKey | LLPWSURDGCEMCP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|