C7H12N8 — CID 110189231
6-azido-2-N-butyl-1,3,5-triazine-2,4-diamine (PubChem CID 110189231) has the molecular formula C7H12N8 and a molecular weight of 208.23 g/mol. Its IUPAC name is 6-azido-2-N-butyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-azido-2-N-butyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 110189231 |
| Molecular Formula | C7H12N8 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 6-azido-2-N-butyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc(N=[N+]=[N-])n1 |
| InChI | InChI=1S/C7H12N8/c1-2-3-4-10-6-11-5(8)12-7(13-6)14-15-9/h2-4H2,1H3,(H3,8,10,11,12,13) |
| InChIKey | HQWAGFNTOVUNLW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|