C33H55N3O2S4 — CID 88736568
4-[[4,6-bis(1-octylsulfanylethylsulfanyl)-1,3,5-triazin-2-yl]oxy]-2-tert-butylphenol (PubChem CID 88736568) has the molecular formula C33H55N3O2S4 and a molecular weight of 654.09 g/mol. Its IUPAC name is 4-[[4,6-bis(1-octylsulfanylethylsulfanyl)-1,3,5-triazin-2-yl]oxy]-2-tert-butylphenol.
| Compound Name | 4-[[4,6-bis(1-octylsulfanylethylsulfanyl)-1,3,5-triazin-2-yl]oxy]-2-tert-butylphenol |
|---|---|
| PubChem CID | 88736568 |
| Molecular Formula | C33H55N3O2S4 |
| Molecular Weight | 654.09 g/mol |
| Exact Mass | 653.32 |
| IUPAC Name | 4-[[4,6-bis(1-octylsulfanylethylsulfanyl)-1,3,5-triazin-2-yl]oxy]-2-tert-butylphenol |
| SMILES | CCCCCCCCSC(C)Sc1nc(Oc2ccc(O)c(C(C)(C)C)c2)nc(SC(C)SCCCCCCCC)n1 |
| InChI | InChI=1S/C33H55N3O2S4/c1-8-10-12-14-16-18-22-39-25(3)41-31-34-30(38-27-20-21-29(37)28(24-27)33(5,6)7)35-32(36-31)42-26(4)40-23-19-17-15-13-11-9-2/h20-21,24-26,37H,8-19,22-23H2,1-7H3 |
| InChIKey | QSEDDFMCBFVMSN-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.09 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|