C33H56N4OS2 — CID 19877226
N-[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-N-(3,5-ditert-butylphenyl)hydroxylamine (PubChem CID 19877226) has the molecular formula C33H56N4OS2 and a molecular weight of 588.97 g/mol. Its IUPAC name is N-[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-N-(3,5-ditert-butylphenyl)hydroxylamine.
| Compound Name | N-[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-N-(3,5-ditert-butylphenyl)hydroxylamine |
|---|---|
| PubChem CID | 19877226 |
| Molecular Formula | C33H56N4OS2 |
| Molecular Weight | 588.97 g/mol |
| Exact Mass | 588.39 |
| IUPAC Name | N-[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]-N-(3,5-ditert-butylphenyl)hydroxylamine |
| SMILES | CCCCCCCCSc1nc(SCCCCCCCC)nc(N(O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)n1 |
| InChI | InChI=1S/C33H56N4OS2/c1-9-11-13-15-17-19-21-39-30-34-29(35-31(36-30)40-22-20-18-16-14-12-10-2)37(38)28-24-26(32(3,4)5)23-27(25-28)33(6,7)8/h23-25,38H,9-22H2,1-8H3 |
| InChIKey | HXMMEBFOFFDGEG-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.97 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|