C33H56N4OS2 — CID 57263592
2-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]-4,6-ditert-butylphenol (PubChem CID 57263592) has the molecular formula C33H56N4OS2 and a molecular weight of 588.97 g/mol. Its IUPAC name is 2-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]-4,6-ditert-butylphenol.
| Compound Name | 2-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 57263592 |
| Molecular Formula | C33H56N4OS2 |
| Molecular Weight | 588.97 g/mol |
| Exact Mass | 588.39 |
| IUPAC Name | 2-[[4,6-bis(octylsulfanyl)-1,3,5-triazin-2-yl]amino]-4,6-ditert-butylphenol |
| SMILES | CCCCCCCCSc1nc(Nc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)nc(SCCCCCCCC)n1 |
| InChI | InChI=1S/C33H56N4OS2/c1-9-11-13-15-17-19-21-39-30-35-29(36-31(37-30)40-22-20-18-16-14-12-10-2)34-27-24-25(32(3,4)5)23-26(28(27)38)33(6,7)8/h23-24,38H,9-22H2,1-8H3,(H,34,35,36,37) |
| InChIKey | PIYZJSNDWZROSK-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.97 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|