C12H18N6S — CID 107765392
4-imidazol-1-yl-N-methyl-6-pentylsulfanyl-1,3,5-triazin-2-amine (PubChem CID 107765392) has the molecular formula C12H18N6S and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-imidazol-1-yl-N-methyl-6-pentylsulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-imidazol-1-yl-N-methyl-6-pentylsulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 107765392 |
| Molecular Formula | C12H18N6S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-imidazol-1-yl-N-methyl-6-pentylsulfanyl-1,3,5-triazin-2-amine |
| SMILES | CCCCCSc1nc(NC)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C12H18N6S/c1-3-4-5-8-19-12-16-10(13-2)15-11(17-12)18-7-6-14-9-18/h6-7,9H,3-5,8H2,1-2H3,(H,13,15,16,17) |
| InChIKey | VXITXZPXPYOXBO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|