C14H14N6S — CID 80872626
4-benzylsulfanyl-6-imidazol-1-yl-N-methyl-1,3,5-triazin-2-amine (PubChem CID 80872626) has the molecular formula C14H14N6S and a molecular weight of 298.38 g/mol. Its IUPAC name is 4-benzylsulfanyl-6-imidazol-1-yl-N-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4-benzylsulfanyl-6-imidazol-1-yl-N-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80872626 |
| Molecular Formula | C14H14N6S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-benzylsulfanyl-6-imidazol-1-yl-N-methyl-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(SCc2ccccc2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C14H14N6S/c1-15-12-17-13(20-8-7-16-10-20)19-14(18-12)21-9-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,15,17,18,19) |
| InChIKey | PZTMQMSXPQHKRQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |