C13H20N4 — CID 106544659
5,6-diethyl-N-hex-5-ynyl-1,2,4-triazin-3-amine (PubChem CID 106544659) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 5,6-diethyl-N-hex-5-ynyl-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-hex-5-ynyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 106544659 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 5,6-diethyl-N-hex-5-ynyl-1,2,4-triazin-3-amine |
| SMILES | C#CCCCCNc1nnc(CC)c(CC)n1 |
| InChI | InChI=1S/C13H20N4/c1-4-7-8-9-10-14-13-15-11(5-2)12(6-3)16-17-13/h1H,5-10H2,2-3H3,(H,14,15,17) |
| InChIKey | WWEPXBBUHJLLKF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|