C13H25N5O2S — CID 105362475
N-[3-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]propyl]-N-ethylmethanesulfonamide (PubChem CID 105362475) has the molecular formula C13H25N5O2S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-[3-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]propyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[3-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]propyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 105362475 |
| Molecular Formula | C13H25N5O2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[3-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]propyl]-N-ethylmethanesulfonamide |
| SMILES | CCc1nnc(NCCCN(CC)S(C)(=O)=O)nc1CC |
| InChI | InChI=1S/C13H25N5O2S/c1-5-11-12(6-2)16-17-13(15-11)14-9-8-10-18(7-3)21(4,19)20/h5-10H2,1-4H3,(H,14,15,17) |
| InChIKey | PQNFYOJUJXATFZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|