C12H21N3O4S2 — CID 114598708
N-ethyl-N-[3-[(3-methylsulfonyl-2-pyridinyl)amino]propyl]methanesulfonamide (PubChem CID 114598708) has the molecular formula C12H21N3O4S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is N-ethyl-N-[3-[(3-methylsulfonyl-2-pyridinyl)amino]propyl]methanesulfonamide.
| Compound Name | N-ethyl-N-[3-[(3-methylsulfonyl-2-pyridinyl)amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 114598708 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-ethyl-N-[3-[(3-methylsulfonyl-2-pyridinyl)amino]propyl]methanesulfonamide |
| SMILES | CCN(CCCNc1ncccc1S(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C12H21N3O4S2/c1-4-15(21(3,18)19)10-6-9-14-12-11(20(2,16)17)7-5-8-13-12/h5,7-8H,4,6,9-10H2,1-3H3,(H,13,14) |
| InChIKey | UTMODTFPQMSAGV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|