C11H19N3O2S — CID 114599239
N'-(3-methylsulfonyl-2-pyridinyl)-N-propylethane-1,2-diamine (PubChem CID 114599239) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is N'-(3-methylsulfonyl-2-pyridinyl)-N-propylethane-1,2-diamine.
| Compound Name | N'-(3-methylsulfonyl-2-pyridinyl)-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 114599239 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N'-(3-methylsulfonyl-2-pyridinyl)-N-propylethane-1,2-diamine |
| SMILES | CCCNCCNc1ncccc1S(C)(=O)=O |
| InChI | InChI=1S/C11H19N3O2S/c1-3-6-12-8-9-14-11-10(17(2,15)16)5-4-7-13-11/h4-5,7,12H,3,6,8-9H2,1-2H3,(H,13,14) |
| InChIKey | MUXZPEPSXSAUHM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|