C13H22N2O2S2 — CID 106544549
N-(2-ethyl-2-methylsulfanylbutyl)-3-methylsulfonylpyridin-2-amine (PubChem CID 106544549) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.46 g/mol. Its IUPAC name is N-(2-ethyl-2-methylsulfanylbutyl)-3-methylsulfonylpyridin-2-amine.
| Compound Name | N-(2-ethyl-2-methylsulfanylbutyl)-3-methylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 106544549 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-(2-ethyl-2-methylsulfanylbutyl)-3-methylsulfonylpyridin-2-amine |
| SMILES | CCC(CC)(CNc1ncccc1S(C)(=O)=O)SC |
| InChI | InChI=1S/C13H22N2O2S2/c1-5-13(6-2,18-3)10-15-12-11(19(4,16)17)8-7-9-14-12/h7-9H,5-6,10H2,1-4H3,(H,14,15) |
| InChIKey | BEWIIJKRCVIYOV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |