C14H19ClN4S2 — CID 114864204
5-[4-chloro-2-(propylaminomethyl)phenyl]sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 114864204) has the molecular formula C14H19ClN4S2 and a molecular weight of 342.92 g/mol. Its IUPAC name is 5-[4-chloro-2-(propylaminomethyl)phenyl]sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[4-chloro-2-(propylaminomethyl)phenyl]sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 114864204 |
| Molecular Formula | C14H19ClN4S2 |
| Molecular Weight | 342.92 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 5-[4-chloro-2-(propylaminomethyl)phenyl]sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCNCc1cc(Cl)ccc1Sc1nnc(N(C)C)s1 |
| InChI | InChI=1S/C14H19ClN4S2/c1-4-7-16-9-10-8-11(15)5-6-12(10)20-14-18-17-13(21-14)19(2)3/h5-6,8,16H,4,7,9H2,1-3H3 |
| InChIKey | REMDASNOAAFLIT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|