C17H19Cl2NS — CID 114865323
N-[[5-chloro-2-[(4-chlorophenyl)methylsulfanyl]phenyl]methyl]propan-1-amine (PubChem CID 114865323) has the molecular formula C17H19Cl2NS and a molecular weight of 340.32 g/mol. Its IUPAC name is N-[[5-chloro-2-[(4-chlorophenyl)methylsulfanyl]phenyl]methyl]propan-1-amine.
| Compound Name | N-[[5-chloro-2-[(4-chlorophenyl)methylsulfanyl]phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114865323 |
| Molecular Formula | C17H19Cl2NS |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | N-[[5-chloro-2-[(4-chlorophenyl)methylsulfanyl]phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Cl)ccc1SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2NS/c1-2-9-20-11-14-10-16(19)7-8-17(14)21-12-13-3-5-15(18)6-4-13/h3-8,10,20H,2,9,11-12H2,1H3 |
| InChIKey | KKPODQNXKRDLNJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|