C13H20ClNO — CID 29224432
N-[(5-chloro-2-propoxyphenyl)methyl]propan-1-amine (PubChem CID 29224432) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is N-[(5-chloro-2-propoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-chloro-2-propoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 29224432 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-[(5-chloro-2-propoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Cl)ccc1OCCC |
| InChI | InChI=1S/C13H20ClNO/c1-3-7-15-10-11-9-12(14)5-6-13(11)16-8-4-2/h5-6,9,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | BEEVAEYAPTVQGM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|