C13H19ClF2N2 — CID 114853665
4-chloro-N-(2,2-difluoroethyl)-N-methyl-2-(propylaminomethyl)aniline (PubChem CID 114853665) has the molecular formula C13H19ClF2N2 and a molecular weight of 276.76 g/mol. Its IUPAC name is 4-chloro-N-(2,2-difluoroethyl)-N-methyl-2-(propylaminomethyl)aniline.
| Compound Name | 4-chloro-N-(2,2-difluoroethyl)-N-methyl-2-(propylaminomethyl)aniline |
|---|---|
| PubChem CID | 114853665 |
| Molecular Formula | C13H19ClF2N2 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-chloro-N-(2,2-difluoroethyl)-N-methyl-2-(propylaminomethyl)aniline |
| SMILES | CCCNCc1cc(Cl)ccc1N(C)CC(F)F |
| InChI | InChI=1S/C13H19ClF2N2/c1-3-6-17-8-10-7-11(14)4-5-12(10)18(2)9-13(15)16/h4-5,7,13,17H,3,6,8-9H2,1-2H3 |
| InChIKey | AALVSOVSIXWKTE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|