C13H21ClN2O — CID 114848634
2-[4-chloro-N-methyl-2-(propylaminomethyl)anilino]ethanol (PubChem CID 114848634) has the molecular formula C13H21ClN2O and a molecular weight of 256.78 g/mol. Its IUPAC name is 2-[4-chloro-N-methyl-2-(propylaminomethyl)anilino]ethanol.
| Compound Name | 2-[4-chloro-N-methyl-2-(propylaminomethyl)anilino]ethanol |
|---|---|
| PubChem CID | 114848634 |
| Molecular Formula | C13H21ClN2O |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-[4-chloro-N-methyl-2-(propylaminomethyl)anilino]ethanol |
| SMILES | CCCNCc1cc(Cl)ccc1N(C)CCO |
| InChI | InChI=1S/C13H21ClN2O/c1-3-6-15-10-11-9-12(14)4-5-13(11)16(2)7-8-17/h4-5,9,15,17H,3,6-8,10H2,1-2H3 |
| InChIKey | SPUFWFCXZKWOHM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|