C15H26ClN3 — CID 114851389
N'-[5-chloro-2-(propylaminomethyl)phenyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 114851389) has the molecular formula C15H26ClN3 and a molecular weight of 283.85 g/mol. Its IUPAC name is N'-[5-chloro-2-(propylaminomethyl)phenyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[5-chloro-2-(propylaminomethyl)phenyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 114851389 |
| Molecular Formula | C15H26ClN3 |
| Molecular Weight | 283.85 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N'-[5-chloro-2-(propylaminomethyl)phenyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CCCNCc1ccc(Cl)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C15H26ClN3/c1-5-8-17-12-13-6-7-14(16)11-15(13)19(4)10-9-18(2)3/h6-7,11,17H,5,8-10,12H2,1-4H3 |
| InChIKey | PSAPFDNDVWIKCE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.85 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|